C16H20S2 — CID 143686160
4-cyclohepta-1,3,6-trien-1-ylsulfanylbenzenethiol;propane (PubChem CID 143686160) has the molecular formula C16H20S2 and a molecular weight of 276.47 g/mol. Its IUPAC name is 4-cyclohepta-1,3,6-trien-1-ylsulfanylbenzenethiol;propane.
| Compound Name | 4-cyclohepta-1,3,6-trien-1-ylsulfanylbenzenethiol;propane |
|---|---|
| PubChem CID | 143686160 |
| Molecular Formula | C16H20S2 |
| Molecular Weight | 276.47 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 4-cyclohepta-1,3,6-trien-1-ylsulfanylbenzenethiol;propane |
| SMILES | CCC.Sc1ccc(SC2=CC=CCC=C2)cc1 |
| InChI | InChI=1S/C13H12S2.C3H8/c14-11-7-9-13(10-8-11)15-12-5-3-1-2-4-6-12;1-3-2/h1,3-10,14H,2H2;3H2,1-2H3 |
| InChIKey | HNTLZGJDDDJVEB-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.47 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|