C10H16N2O — CID 143686561
(1E,3E,6Z)-1-amino-1-(methylamino)-5-methylideneocta-1,3,6-trien-3-ol (PubChem CID 143686561) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is (1E,3E,6Z)-1-amino-1-(methylamino)-5-methylideneocta-1,3,6-trien-3-ol.
| Compound Name | (1E,3E,6Z)-1-amino-1-(methylamino)-5-methylideneocta-1,3,6-trien-3-ol |
|---|---|
| PubChem CID | 143686561 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | (1E,3E,6Z)-1-amino-1-(methylamino)-5-methylideneocta-1,3,6-trien-3-ol |
| SMILES | C=C(/C=C\C)/C=C(O)\C=C(/N)NC |
| InChI | InChI=1S/C10H16N2O/c1-4-5-8(2)6-9(13)7-10(11)12-3/h4-7,12-13H,2,11H2,1,3H3/b5-4-,9-6+,10-7+ |
| InChIKey | BPRKXZLQZGHJMX-RPINECDISA-N |
| XLogP | 1.58 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|