C8H12N2O — CID 163477952
(4Z)-4-[(aminomethylamino)methylidene]cyclohexa-1,5-dien-1-ol (PubChem CID 163477952) has the molecular formula C8H12N2O and a molecular weight of 152.20 g/mol. Its IUPAC name is (4Z)-4-[(aminomethylamino)methylidene]cyclohexa-1,5-dien-1-ol.
| Compound Name | (4Z)-4-[(aminomethylamino)methylidene]cyclohexa-1,5-dien-1-ol |
|---|---|
| PubChem CID | 163477952 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | (4Z)-4-[(aminomethylamino)methylidene]cyclohexa-1,5-dien-1-ol |
| SMILES | NCN/C=C1\C=CC(O)=CC1 |
| InChI | InChI=1S/C8H12N2O/c9-6-10-5-7-1-3-8(11)4-2-7/h1,3-5,10-11H,2,6,9H2/b7-5+ |
| InChIKey | CCBIZYHZTZZOQW-FNORWQNLSA-N |
| XLogP | 0.78 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|