C24H28ClNO3 — CID 143687481
(E)-3-(5-chloro-2-methylphenyl)-1-[4-(2,6-dimethoxyphenyl)piperidin-1-yl]-2-methylprop-2-en-1-one (PubChem CID 143687481) has the molecular formula C24H28ClNO3 and a molecular weight of 413.95 g/mol. Its IUPAC name is (E)-3-(5-chloro-2-methylphenyl)-1-[4-(2,6-dimethoxyphenyl)piperidin-1-yl]-2-methylprop-2-en-1-one.
| Compound Name | (E)-3-(5-chloro-2-methylphenyl)-1-[4-(2,6-dimethoxyphenyl)piperidin-1-yl]-2-methylprop-2-en-1-one |
|---|---|
| PubChem CID | 143687481 |
| Molecular Formula | C24H28ClNO3 |
| Molecular Weight | 413.95 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | (E)-3-(5-chloro-2-methylphenyl)-1-[4-(2,6-dimethoxyphenyl)piperidin-1-yl]-2-methylprop-2-en-1-one |
| SMILES | COc1cccc(OC)c1C1CCN(C(=O)/C(C)=C/c2cc(Cl)ccc2C)CC1 |
| InChI | InChI=1S/C24H28ClNO3/c1-16-8-9-20(25)15-19(16)14-17(2)24(27)26-12-10-18(11-13-26)23-21(28-3)6-5-7-22(23)29-4/h5-9,14-15,18H,10-13H2,1-4H3/b17-14+ |
| InChIKey | JPXJBRBNPLBLJK-SAPNQHFASA-N |
| XLogP | 5.48 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.95 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|