C6H8N2O — CID 14368849
6,8-dihydro-5H-imidazo[5,1-c][1,4]oxazine (PubChem CID 14368849) has the molecular formula C6H8N2O and a molecular weight of 124.14 g/mol. Its IUPAC name is 6,8-dihydro-5H-imidazo[5,1-c][1,4]oxazine.
| Compound Name | 6,8-dihydro-5H-imidazo[5,1-c][1,4]oxazine |
|---|---|
| PubChem CID | 14368849 |
| Molecular Formula | C6H8N2O |
| Molecular Weight | 124.14 g/mol |
| Exact Mass | 124.06 |
| IUPAC Name | 6,8-dihydro-5H-imidazo[5,1-c][1,4]oxazine |
| SMILES | c1ncn2c1COCC2 |
| InChI | InChI=1S/C6H8N2O/c1-2-9-4-6-3-7-5-8(1)6/h3,5H,1-2,4H2 |
| InChIKey | QCRCMKPGYVWZEH-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.14 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |