C14H24N2O5 — CID 164575614
18-methyl-3,6,9,12,15-pentaoxa-18,20-diazabicyclo[15.2.1]icosa-1(19),17(20)-diene (PubChem CID 164575614) has the molecular formula C14H24N2O5 and a molecular weight of 300.36 g/mol. Its IUPAC name is 18-methyl-3,6,9,12,15-pentaoxa-18,20-diazabicyclo[15.2.1]icosa-1(19),17(20)-diene.
| Compound Name | 18-methyl-3,6,9,12,15-pentaoxa-18,20-diazabicyclo[15.2.1]icosa-1(19),17(20)-diene |
|---|---|
| PubChem CID | 164575614 |
| Molecular Formula | C14H24N2O5 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 18-methyl-3,6,9,12,15-pentaoxa-18,20-diazabicyclo[15.2.1]icosa-1(19),17(20)-diene |
| SMILES | Cn1cc2nc1COCCOCCOCCOCCOC2 |
| InChI | InChI=1S/C14H24N2O5/c1-16-10-13-11-20-8-6-18-4-2-17-3-5-19-7-9-21-12-14(16)15-13/h10H,2-9,11-12H2,1H3 |
| InChIKey | WSHYONNGBCQOAQ-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 63.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |