C11H13FO3S — CID 143689271
2-[2-fluoro-5-(sulfanylmethyl)phenoxy]-2-methylpropanoic acid (PubChem CID 143689271) has the molecular formula C11H13FO3S and a molecular weight of 244.29 g/mol. Its IUPAC name is 2-[2-fluoro-5-(sulfanylmethyl)phenoxy]-2-methylpropanoic acid.
| Compound Name | 2-[2-fluoro-5-(sulfanylmethyl)phenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 143689271 |
| Molecular Formula | C11H13FO3S |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 2-[2-fluoro-5-(sulfanylmethyl)phenoxy]-2-methylpropanoic acid |
| SMILES | CC(C)(Oc1cc(CS)ccc1F)C(=O)O |
| InChI | InChI=1S/C11H13FO3S/c1-11(2,10(13)14)15-9-5-7(6-16)3-4-8(9)12/h3-5,16H,6H2,1-2H3,(H,13,14) |
| InChIKey | LLACEUANBOPKCE-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|