C32H42F3N5O4S — CID 143689761
2-piperidin-1-yl-N-[4-[4-[[1-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]methoxy]phenyl]phenyl]sulfanylethanamine;2,2,2-trifluoroacetic acid (PubChem CID 143689761) has the molecular formula C32H42F3N5O4S and a molecular weight of 649.78 g/mol. Its IUPAC name is 2-piperidin-1-yl-N-[4-[4-[[1-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]methoxy]phenyl]phenyl]sulfanylethanamine;2,2,2-trifluoroacetic acid.
| Compound Name | 2-piperidin-1-yl-N-[4-[4-[[1-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]methoxy]phenyl]phenyl]sulfanylethanamine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 143689761 |
| Molecular Formula | C32H42F3N5O4S |
| Molecular Weight | 649.78 g/mol |
| Exact Mass | 649.29 |
| IUPAC Name | 2-piperidin-1-yl-N-[4-[4-[[1-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]methoxy]phenyl]phenyl]sulfanylethanamine;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)c1noc(N2CCC(COc3ccc(-c4ccc(SNCCN5CCCCC5)cc4)cc3)CC2)n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C30H41N5O2S.C2HF3O2/c1-23(2)29-32-30(37-33-29)35-19-14-24(15-20-35)22-36-27-10-6-25(7-11-27)26-8-12-28(13-9-26)38-31-16-21-34-17-4-3-5-18-34;3-2(4,5)1(6)7/h6-13,23-24,31H,3-5,14-22H2,1-2H3;(H,6,7) |
| InChIKey | OREODSIFLICAHM-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 103.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.78 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|