C10H7N3O — CID 14369048
2-(furan-2-yl)-1H-imidazo[4,5-b]pyridine (PubChem CID 14369048) has the molecular formula C10H7N3O and a molecular weight of 185.19 g/mol. Its IUPAC name is 2-(furan-2-yl)-1H-imidazo[4,5-b]pyridine.
| Compound Name | 2-(furan-2-yl)-1H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 14369048 |
| Molecular Formula | C10H7N3O |
| Molecular Weight | 185.19 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | 2-(furan-2-yl)-1H-imidazo[4,5-b]pyridine |
| SMILES | c1coc(-c2nc3ncccc3[nH]2)c1 |
| InChI | InChI=1S/C10H7N3O/c1-3-7-9(11-5-1)13-10(12-7)8-4-2-6-14-8/h1-6H,(H,11,12,13) |
| InChIKey | RXGDUSPNSHCSNI-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.19 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |