C17H28ClNO3 — CID 143691612
N-[1-(3-chlorophenyl)propan-2-yl]-2-methylpropan-2-amine;3-methoxypropanoic acid (PubChem CID 143691612) has the molecular formula C17H28ClNO3 and a molecular weight of 329.87 g/mol. Its IUPAC name is N-[1-(3-chlorophenyl)propan-2-yl]-2-methylpropan-2-amine;3-methoxypropanoic acid.
| Compound Name | N-[1-(3-chlorophenyl)propan-2-yl]-2-methylpropan-2-amine;3-methoxypropanoic acid |
|---|---|
| PubChem CID | 143691612 |
| Molecular Formula | C17H28ClNO3 |
| Molecular Weight | 329.87 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | N-[1-(3-chlorophenyl)propan-2-yl]-2-methylpropan-2-amine;3-methoxypropanoic acid |
| SMILES | CC(Cc1cccc(Cl)c1)NC(C)(C)C.COCCC(=O)O |
| InChI | InChI=1S/C13H20ClN.C4H8O3/c1-10(15-13(2,3)4)8-11-6-5-7-12(14)9-11;1-7-3-2-4(5)6/h5-7,9-10,15H,8H2,1-4H3;2-3H2,1H3,(H,5,6) |
| InChIKey | JAGCAVYJCXUBGO-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.87 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |