C31H32N2O4 — CID 143692652
2-(5-benzhydryl-2-oxo-1-pyridinyl)acetaldehyde;3-[3-(methylaminomethyl)phenoxy]prop-1-en-2-ol (PubChem CID 143692652) has the molecular formula C31H32N2O4 and a molecular weight of 496.61 g/mol. Its IUPAC name is 2-(5-benzhydryl-2-oxo-1-pyridinyl)acetaldehyde;3-[3-(methylaminomethyl)phenoxy]prop-1-en-2-ol.
| Compound Name | 2-(5-benzhydryl-2-oxo-1-pyridinyl)acetaldehyde;3-[3-(methylaminomethyl)phenoxy]prop-1-en-2-ol |
|---|---|
| PubChem CID | 143692652 |
| Molecular Formula | C31H32N2O4 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.24 |
| IUPAC Name | 2-(5-benzhydryl-2-oxo-1-pyridinyl)acetaldehyde;3-[3-(methylaminomethyl)phenoxy]prop-1-en-2-ol |
| SMILES | C=C(O)COc1cccc(CNC)c1.O=CCn1cc(C(c2ccccc2)c2ccccc2)ccc1=O |
| InChI | InChI=1S/C20H17NO2.C11H15NO2/c22-14-13-21-15-18(11-12-19(21)23)20(16-7-3-1-4-8-16)17-9-5-2-6-10-17;1-9(13)8-14-11-5-3-4-10(6-11)7-12-2/h1-12,14-15,20H,13H2;3-6,12-13H,1,7-8H2,2H3 |
| InChIKey | YHQRLASPHSWSOH-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|