C31H43N3O — CID 143692856
N-[[3,5-bis[(N-methylanilino)methyl]cyclohexyl]methyl]-N-phenylhydroxylamine;ethane (PubChem CID 143692856) has the molecular formula C31H43N3O and a molecular weight of 473.71 g/mol. Its IUPAC name is N-[[3,5-bis[(N-methylanilino)methyl]cyclohexyl]methyl]-N-phenylhydroxylamine;ethane.
| Compound Name | N-[[3,5-bis[(N-methylanilino)methyl]cyclohexyl]methyl]-N-phenylhydroxylamine;ethane |
|---|---|
| PubChem CID | 143692856 |
| Molecular Formula | C31H43N3O |
| Molecular Weight | 473.71 g/mol |
| Exact Mass | 473.34 |
| IUPAC Name | N-[[3,5-bis[(N-methylanilino)methyl]cyclohexyl]methyl]-N-phenylhydroxylamine;ethane |
| SMILES | CC.CN(CC1CC(CN(C)c2ccccc2)CC(CN(O)c2ccccc2)C1)c1ccccc1 |
| InChI | InChI=1S/C29H37N3O.C2H6/c1-30(27-12-6-3-7-13-27)21-24-18-25(22-31(2)28-14-8-4-9-15-28)20-26(19-24)23-32(33)29-16-10-5-11-17-29;1-2/h3-17,24-26,33H,18-23H2,1-2H3;1-2H3 |
| InChIKey | RNRSDNOJXAOUIH-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 29.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.71 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|