C18H23N3O2 — CID 143693037
6'-imino-1'-(3-methoxyphenyl)spiro[1-azabicyclo[2.2.2]octane-3,4'-piperidine]-2'-one (PubChem CID 143693037) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is 6'-imino-1'-(3-methoxyphenyl)spiro[1-azabicyclo[2.2.2]octane-3,4'-piperidine]-2'-one.
| Compound Name | 6'-imino-1'-(3-methoxyphenyl)spiro[1-azabicyclo[2.2.2]octane-3,4'-piperidine]-2'-one |
|---|---|
| PubChem CID | 143693037 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 6'-imino-1'-(3-methoxyphenyl)spiro[1-azabicyclo[2.2.2]octane-3,4'-piperidine]-2'-one |
| SMILES | [H]/N=C1\CC2(CC(=O)N1c1cccc(OC)c1)CN1CCC2CC1 |
| InChI | InChI=1S/C18H23N3O2/c1-23-15-4-2-3-14(9-15)21-16(19)10-18(11-17(21)22)12-20-7-5-13(18)6-8-20/h2-4,9,13,19H,5-8,10-12H2,1H3/b19-16+ |
| InChIKey | GZBGGQYNJQBYHZ-KNTRCKAVSA-N |
| XLogP | 2.51 |
| TPSA | 56.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|