C17H21N3O3 — CID 15603037
4-imino-3-(4-methoxyphenyl)spiro[1,3-oxazinane-6,3'-1-azabicyclo[2.2.2]octane]-2-one (PubChem CID 15603037) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is 4-imino-3-(4-methoxyphenyl)spiro[1,3-oxazinane-6,3'-1-azabicyclo[2.2.2]octane]-2-one.
| Compound Name | 4-imino-3-(4-methoxyphenyl)spiro[1,3-oxazinane-6,3'-1-azabicyclo[2.2.2]octane]-2-one |
|---|---|
| PubChem CID | 15603037 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 4-imino-3-(4-methoxyphenyl)spiro[1,3-oxazinane-6,3'-1-azabicyclo[2.2.2]octane]-2-one |
| SMILES | [H]/N=C1\CC2(CN3CCC2CC3)OC(=O)N1c1ccc(OC)cc1 |
| InChI | InChI=1S/C17H21N3O3/c1-22-14-4-2-13(3-5-14)20-15(18)10-17(23-16(20)21)11-19-8-6-12(17)7-9-19/h2-5,12,18H,6-11H2,1H3/b18-15+ |
| InChIKey | USZRAWRLDPPJSM-OBGWFSINSA-N |
| XLogP | 2.48 |
| TPSA | 65.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|