C27H27F3N4O — CID 143696014
3-cyano-N-[[6-(dipropylamino)-3-pyridinyl]methyl]-N-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 143696014) has the molecular formula C27H27F3N4O and a molecular weight of 480.53 g/mol. Its IUPAC name is 3-cyano-N-[[6-(dipropylamino)-3-pyridinyl]methyl]-N-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3-cyano-N-[[6-(dipropylamino)-3-pyridinyl]methyl]-N-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 143696014 |
| Molecular Formula | C27H27F3N4O |
| Molecular Weight | 480.53 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | 3-cyano-N-[[6-(dipropylamino)-3-pyridinyl]methyl]-N-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | CCCN(CCC)c1ccc(CN(C(=O)c2cccc(C#N)c2)c2cccc(C(F)(F)F)c2)cn1 |
| InChI | InChI=1S/C27H27F3N4O/c1-3-13-33(14-4-2)25-12-11-21(18-32-25)19-34(24-10-6-9-23(16-24)27(28,29)30)26(35)22-8-5-7-20(15-22)17-31/h5-12,15-16,18H,3-4,13-14,19H2,1-2H3 |
| InChIKey | RAAGHIHQMVVYST-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 60.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.53 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |