C21H25ClN4O — CID 143696048
4-chloro-N-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-N-prop-2-enylbenzamide (PubChem CID 143696048) has the molecular formula C21H25ClN4O and a molecular weight of 384.91 g/mol. Its IUPAC name is 4-chloro-N-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-N-prop-2-enylbenzamide.
| Compound Name | 4-chloro-N-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 143696048 |
| Molecular Formula | C21H25ClN4O |
| Molecular Weight | 384.91 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 4-chloro-N-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-N-prop-2-enylbenzamide |
| SMILES | C=CCN(Cc1ccc(N2CCN(C)CC2)nc1)C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H25ClN4O/c1-3-10-26(21(27)18-5-7-19(22)8-6-18)16-17-4-9-20(23-15-17)25-13-11-24(2)12-14-25/h3-9,15H,1,10-14,16H2,2H3 |
| InChIKey | FPSRNUAWAVEVRK-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.91 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|