C15H20N2OS2 — CID 143696586
3-[6-(methyldisulfanyl)hexyl]pyrido[1,2-a]pyrimidin-4-one (PubChem CID 143696586) has the molecular formula C15H20N2OS2 and a molecular weight of 308.47 g/mol. Its IUPAC name is 3-[6-(methyldisulfanyl)hexyl]pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 3-[6-(methyldisulfanyl)hexyl]pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 143696586 |
| Molecular Formula | C15H20N2OS2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 3-[6-(methyldisulfanyl)hexyl]pyrido[1,2-a]pyrimidin-4-one |
| SMILES | CSSCCCCCCc1cnc2ccccn2c1=O |
| InChI | InChI=1S/C15H20N2OS2/c1-19-20-11-7-3-2-4-8-13-12-16-14-9-5-6-10-17(14)15(13)18/h5-6,9-10,12H,2-4,7-8,11H2,1H3 |
| InChIKey | KDCCQYINMZYISM-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|