C14H9ClN2OS — CID 135045687
3-(4-chlorophenyl)sulfanylpyrido[1,2-a]pyrimidin-4-one (PubChem CID 135045687) has the molecular formula C14H9ClN2OS and a molecular weight of 288.76 g/mol. Its IUPAC name is 3-(4-chlorophenyl)sulfanylpyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 3-(4-chlorophenyl)sulfanylpyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 135045687 |
| Molecular Formula | C14H9ClN2OS |
| Molecular Weight | 288.76 g/mol |
| Exact Mass | 288.01 |
| IUPAC Name | 3-(4-chlorophenyl)sulfanylpyrido[1,2-a]pyrimidin-4-one |
| SMILES | O=c1c(Sc2ccc(Cl)cc2)cnc2ccccn12 |
| InChI | InChI=1S/C14H9ClN2OS/c15-10-4-6-11(7-5-10)19-12-9-16-13-3-1-2-8-17(13)14(12)18/h1-9H |
| InChIKey | CRGJCQBXHWJZLF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.76 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |