C15H10ClN3O2 — CID 4572245
N-(2-chlorophenyl)-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide (PubChem CID 4572245) has the molecular formula C15H10ClN3O2 and a molecular weight of 299.72 g/mol. Its IUPAC name is N-(2-chlorophenyl)-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide.
| Compound Name | N-(2-chlorophenyl)-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 4572245 |
| Molecular Formula | C15H10ClN3O2 |
| Molecular Weight | 299.72 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | N-(2-chlorophenyl)-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1Cl)c1cnc2ccccn2c1=O |
| InChI | InChI=1S/C15H10ClN3O2/c16-11-5-1-2-6-12(11)18-14(20)10-9-17-13-7-3-4-8-19(13)15(10)21/h1-9H,(H,18,20) |
| InChIKey | QIMLVGPJQZKNMW-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.72 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |