C15H10Cl2N4O2 — CID 16621733
N-(4-amino-3,5-dichlorophenyl)-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide (PubChem CID 16621733) has the molecular formula C15H10Cl2N4O2 and a molecular weight of 349.18 g/mol. Its IUPAC name is N-(4-amino-3,5-dichlorophenyl)-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide.
| Compound Name | N-(4-amino-3,5-dichlorophenyl)-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 16621733 |
| Molecular Formula | C15H10Cl2N4O2 |
| Molecular Weight | 349.18 g/mol |
| Exact Mass | 348.02 |
| IUPAC Name | N-(4-amino-3,5-dichlorophenyl)-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide |
| SMILES | Nc1c(Cl)cc(NC(=O)c2cnc3ccccn3c2=O)cc1Cl |
| InChI | InChI=1S/C15H10Cl2N4O2/c16-10-5-8(6-11(17)13(10)18)20-14(22)9-7-19-12-3-1-2-4-21(12)15(9)23/h1-7H,18H2,(H,20,22) |
| InChIKey | IJKKWKBRQKUUPS-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 89.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.18 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|