About 4-fluoro-N-methyl-3-(trifluoromethyl)cyclohexa-1,3-dien-1-amine
4-fluoro-N-methyl-3-(trifluoromethyl)cyclohexa-1,3-dien-1-amine (PubChem CID 143696817) has the molecular formula C8H9F4N
and a molecular weight of 195.16 g/mol. Its IUPAC name is 4-fluoro-N-methyl-3-(trifluoromethyl)cyclohexa-1,3-dien-1-amine.
Molecular Properties
| Compound Name | 4-fluoro-N-methyl-3-(trifluoromethyl)cyclohexa-1,3-dien-1-amine |
| PubChem CID | 143696817 |
| Molecular Formula | C8H9F4N |
| Molecular Weight | 195.16 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | 4-fluoro-N-methyl-3-(trifluoromethyl)cyclohexa-1,3-dien-1-amine |
| SMILES | CNC1=CC(C(F)(F)F)=C(F)CC1 |
| InChI | InChI=1S/C8H9F4N/c1-13-5-2-3-7(9)6(4-5)8(10,11)12/h4,13H,2-3H2,1H3 |
| InChIKey | WHSSTCBRJBCQHQ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.16 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-fluoro-N-methyl-3-(trifluoromethyl)cyclohexa-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-N-methyl-3-(trifluoromethyl)cyclohexa-1,3-dien-1-amine?
The IUPAC name of 4-fluoro-N-methyl-3-(trifluoromethyl)cyclohexa-1,3-dien-1-amine (CID 143696817) is 4-fluoro-N-methyl-3-(trifluoromethyl)cyclohexa-1,3-dien-1-amine.
What is the SMILES notation for 4-fluoro-N-methyl-3-(trifluoromethyl)cyclohexa-1,3-dien-1-amine?
The canonical SMILES for 4-fluoro-N-methyl-3-(trifluoromethyl)cyclohexa-1,3-dien-1-amine is CNC1=CC(C(F)(F)F)=C(F)CC1.
What is the InChIKey of 4-fluoro-N-methyl-3-(trifluoromethyl)cyclohexa-1,3-dien-1-amine?
The InChIKey is WHSSTCBRJBCQHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F4N/c1-13-5-2-3-7(9)6(4-5)8(10,11)12/h4,13H,2-3H2,1H3.
What are the key properties of 4-fluoro-N-methyl-3-(trifluoromethyl)cyclohexa-1,3-dien-1-amine?
4-fluoro-N-methyl-3-(trifluoromethyl)cyclohexa-1,3-dien-1-amine has a molecular weight of 195.16 g/mol, XLogP of 2.67, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-N-methyl-3-(trifluoromethyl)cyclohexa-1,3-dien-1-amine is sourced from PubChem (CID 143696817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).