C12H18N6O2 — CID 143698242
4-[2-[(methoxyamino)methyl]morpholin-4-yl]-7H-pyrrolo[2,3-d]pyrimidin-2-amine (PubChem CID 143698242) has the molecular formula C12H18N6O2 and a molecular weight of 278.32 g/mol. Its IUPAC name is 4-[2-[(methoxyamino)methyl]morpholin-4-yl]-7H-pyrrolo[2,3-d]pyrimidin-2-amine.
| Compound Name | 4-[2-[(methoxyamino)methyl]morpholin-4-yl]-7H-pyrrolo[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 143698242 |
| Molecular Formula | C12H18N6O2 |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 4-[2-[(methoxyamino)methyl]morpholin-4-yl]-7H-pyrrolo[2,3-d]pyrimidin-2-amine |
| SMILES | CONCC1CN(c2nc(N)nc3[nH]ccc23)CCO1 |
| InChI | InChI=1S/C12H18N6O2/c1-19-15-6-8-7-18(4-5-20-8)11-9-2-3-14-10(9)16-12(13)17-11/h2-3,8,15H,4-7H2,1H3,(H3,13,14,16,17) |
| InChIKey | YSALPTOUOLFPTM-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 101.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|