C25H33N7O2 — CID 143698271
ethane;[4-[5-[1-(2-phenylmethoxyethyl)pyrazol-4-yl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]morpholin-2-yl]methanamine (PubChem CID 143698271) has the molecular formula C25H33N7O2 and a molecular weight of 463.59 g/mol. Its IUPAC name is ethane;[4-[5-[1-(2-phenylmethoxyethyl)pyrazol-4-yl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]morpholin-2-yl]methanamine.
| Compound Name | ethane;[4-[5-[1-(2-phenylmethoxyethyl)pyrazol-4-yl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]morpholin-2-yl]methanamine |
|---|---|
| PubChem CID | 143698271 |
| Molecular Formula | C25H33N7O2 |
| Molecular Weight | 463.59 g/mol |
| Exact Mass | 463.27 |
| IUPAC Name | ethane;[4-[5-[1-(2-phenylmethoxyethyl)pyrazol-4-yl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]morpholin-2-yl]methanamine |
| SMILES | CC.NCC1CN(c2ncnc3[nH]cc(-c4cnn(CCOCc5ccccc5)c4)c23)CCO1 |
| InChI | InChI=1S/C23H27N7O2.C2H6/c24-10-19-14-29(6-9-32-19)23-21-20(12-25-22(21)26-16-27-23)18-11-28-30(13-18)7-8-31-15-17-4-2-1-3-5-17;1-2/h1-5,11-13,16,19H,6-10,14-15,24H2,(H,25,26,27);1-2H3 |
| InChIKey | QQXHVFIMPZEKGP-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 107.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.59 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|