C27H35F3N4O2S — CID 143698652
1-[2-[[methyl(propylidene)-λ4-sulfanyl]amino]ethyl]-3-[2-methyl-5-[4-[4-(trifluoromethyl)phenyl]piperidine-1-carbonyl]phenyl]urea (PubChem CID 143698652) has the molecular formula C27H35F3N4O2S and a molecular weight of 536.66 g/mol. Its IUPAC name is 1-[2-[[methyl(propylidene)-λ4-sulfanyl]amino]ethyl]-3-[2-methyl-5-[4-[4-(trifluoromethyl)phenyl]piperidine-1-carbonyl]phenyl]urea.
| Compound Name | 1-[2-[[methyl(propylidene)-λ4-sulfanyl]amino]ethyl]-3-[2-methyl-5-[4-[4-(trifluoromethyl)phenyl]piperidine-1-carbonyl]phenyl]urea |
|---|---|
| PubChem CID | 143698652 |
| Molecular Formula | C27H35F3N4O2S |
| Molecular Weight | 536.66 g/mol |
| Exact Mass | 536.24 |
| IUPAC Name | 1-[2-[[methyl(propylidene)-λ4-sulfanyl]amino]ethyl]-3-[2-methyl-5-[4-[4-(trifluoromethyl)phenyl]piperidine-1-carbonyl]phenyl]urea |
| SMILES | CCC=S(C)NCCNC(=O)Nc1cc(C(=O)N2CCC(c3ccc(C(F)(F)F)cc3)CC2)ccc1C |
| InChI | InChI=1S/C27H35F3N4O2S/c1-4-17-37(3)32-14-13-31-26(36)33-24-18-22(6-5-19(24)2)25(35)34-15-11-21(12-16-34)20-7-9-23(10-8-20)27(28,29)30/h5-10,17-18,21,32H,4,11-16H2,1-3H3,(H2,31,33,36) |
| InChIKey | MIACQRYCVGEMIA-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.66 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|