C21H26N2O5S2 — CID 25153153
N-[2-methyl-5-[4-(4-methylsulfonylphenyl)piperidine-1-carbonyl]phenyl]methanesulfonamide (PubChem CID 25153153) has the molecular formula C21H26N2O5S2 and a molecular weight of 450.58 g/mol. Its IUPAC name is N-[2-methyl-5-[4-(4-methylsulfonylphenyl)piperidine-1-carbonyl]phenyl]methanesulfonamide.
| Compound Name | N-[2-methyl-5-[4-(4-methylsulfonylphenyl)piperidine-1-carbonyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 25153153 |
| Molecular Formula | C21H26N2O5S2 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | N-[2-methyl-5-[4-(4-methylsulfonylphenyl)piperidine-1-carbonyl]phenyl]methanesulfonamide |
| SMILES | Cc1ccc(C(=O)N2CCC(c3ccc(S(C)(=O)=O)cc3)CC2)cc1NS(C)(=O)=O |
| InChI | InChI=1S/C21H26N2O5S2/c1-15-4-5-18(14-20(15)22-30(3,27)28)21(24)23-12-10-17(11-13-23)16-6-8-19(9-7-16)29(2,25)26/h4-9,14,17,22H,10-13H2,1-3H3 |
| InChIKey | HGTYFQSLNGEPAQ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |