C27H31N3O5S2 — CID 89194941
N-[5-[4-(4-aminophenyl)piperidine-1-carbonyl]-2-methylphenyl]-1-(4-methylsulfonylphenyl)methanesulfonamide (PubChem CID 89194941) has the molecular formula C27H31N3O5S2 and a molecular weight of 541.70 g/mol. Its IUPAC name is N-[5-[4-(4-aminophenyl)piperidine-1-carbonyl]-2-methylphenyl]-1-(4-methylsulfonylphenyl)methanesulfonamide.
| Compound Name | N-[5-[4-(4-aminophenyl)piperidine-1-carbonyl]-2-methylphenyl]-1-(4-methylsulfonylphenyl)methanesulfonamide |
|---|---|
| PubChem CID | 89194941 |
| Molecular Formula | C27H31N3O5S2 |
| Molecular Weight | 541.70 g/mol |
| Exact Mass | 541.17 |
| IUPAC Name | N-[5-[4-(4-aminophenyl)piperidine-1-carbonyl]-2-methylphenyl]-1-(4-methylsulfonylphenyl)methanesulfonamide |
| SMILES | Cc1ccc(C(=O)N2CCC(c3ccc(N)cc3)CC2)cc1NS(=O)(=O)Cc1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C27H31N3O5S2/c1-19-3-6-23(27(31)30-15-13-22(14-16-30)21-7-9-24(28)10-8-21)17-26(19)29-37(34,35)18-20-4-11-25(12-5-20)36(2,32)33/h3-12,17,22,29H,13-16,18,28H2,1-2H3 |
| InChIKey | BFDWMLKIEPXUJH-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.70 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|