C18H17N5S2 — CID 143701591
1-(1H-imidazol-5-ylmethyl)-4-thiophen-2-ylsulfanyl-3,5-dihydro-2H-1,4-benzodiazepine-7-carbonitrile (PubChem CID 143701591) has the molecular formula C18H17N5S2 and a molecular weight of 367.50 g/mol. Its IUPAC name is 1-(1H-imidazol-5-ylmethyl)-4-thiophen-2-ylsulfanyl-3,5-dihydro-2H-1,4-benzodiazepine-7-carbonitrile.
| Compound Name | 1-(1H-imidazol-5-ylmethyl)-4-thiophen-2-ylsulfanyl-3,5-dihydro-2H-1,4-benzodiazepine-7-carbonitrile |
|---|---|
| PubChem CID | 143701591 |
| Molecular Formula | C18H17N5S2 |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 1-(1H-imidazol-5-ylmethyl)-4-thiophen-2-ylsulfanyl-3,5-dihydro-2H-1,4-benzodiazepine-7-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)CN(Sc1cccs1)CCN2Cc1cnc[nH]1 |
| InChI | InChI=1S/C18H17N5S2/c19-9-14-3-4-17-15(8-14)11-23(25-18-2-1-7-24-18)6-5-22(17)12-16-10-20-13-21-16/h1-4,7-8,10,13H,5-6,11-12H2,(H,20,21) |
| InChIKey | WVMKYKRKMDFLON-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|