C13H15N3O — CID 24951527
1-(1H-imidazol-5-ylmethyl)-5-methoxy-2,3-dihydroindole (PubChem CID 24951527) has the molecular formula C13H15N3O and a molecular weight of 229.28 g/mol. Its IUPAC name is 1-(1H-imidazol-5-ylmethyl)-5-methoxy-2,3-dihydroindole.
| Compound Name | 1-(1H-imidazol-5-ylmethyl)-5-methoxy-2,3-dihydroindole |
|---|---|
| PubChem CID | 24951527 |
| Molecular Formula | C13H15N3O |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 1-(1H-imidazol-5-ylmethyl)-5-methoxy-2,3-dihydroindole |
| SMILES | COc1ccc2c(c1)CCN2Cc1cnc[nH]1 |
| InChI | InChI=1S/C13H15N3O/c1-17-12-2-3-13-10(6-12)4-5-16(13)8-11-7-14-9-15-11/h2-3,6-7,9H,4-5,8H2,1H3,(H,14,15) |
| InChIKey | LJQGGZRJQSSDLK-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|