C18H25N5O — CID 143737353
methyl N,N'-diethyl-N-[1-(1H-imidazol-5-ylmethyl)-2,3-dihydroindol-6-yl]carbamimidate (PubChem CID 143737353) has the molecular formula C18H25N5O and a molecular weight of 327.43 g/mol. Its IUPAC name is methyl N,N'-diethyl-N-[1-(1H-imidazol-5-ylmethyl)-2,3-dihydroindol-6-yl]carbamimidate.
| Compound Name | methyl N,N'-diethyl-N-[1-(1H-imidazol-5-ylmethyl)-2,3-dihydroindol-6-yl]carbamimidate |
|---|---|
| PubChem CID | 143737353 |
| Molecular Formula | C18H25N5O |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.21 |
| IUPAC Name | methyl N,N'-diethyl-N-[1-(1H-imidazol-5-ylmethyl)-2,3-dihydroindol-6-yl]carbamimidate |
| SMILES | CC/N=C(\OC)N(CC)c1ccc2c(c1)N(Cc1cnc[nH]1)CC2 |
| InChI | InChI=1S/C18H25N5O/c1-4-20-18(24-3)23(5-2)16-7-6-14-8-9-22(17(14)10-16)12-15-11-19-13-21-15/h6-7,10-11,13H,4-5,8-9,12H2,1-3H3,(H,19,21)/b20-18- |
| InChIKey | GBCLRERSMSKVIF-ZZEZOPTASA-N |
| XLogP | 2.82 |
| TPSA | 56.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|