C23H32O — CID 143701747
(10R)-6,10,13-trimethyl-17-prop-1-en-2-yl-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 143701747) has the molecular formula C23H32O and a molecular weight of 324.51 g/mol. Its IUPAC name is (10R)-6,10,13-trimethyl-17-prop-1-en-2-yl-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (10R)-6,10,13-trimethyl-17-prop-1-en-2-yl-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 143701747 |
| Molecular Formula | C23H32O |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.25 |
| IUPAC Name | (10R)-6,10,13-trimethyl-17-prop-1-en-2-yl-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C=C(C)C1CCC2C3C=C(C)C4=CC(=O)CC[C@]4(C)C3CCC12C |
| InChI | InChI=1S/C23H32O/c1-14(2)18-6-7-19-17-12-15(3)21-13-16(24)8-10-23(21,5)20(17)9-11-22(18,19)4/h12-13,17-20H,1,6-11H2,2-5H3/t17?,18?,19?,20?,22?,23-/m1/s1 |
| InChIKey | LQUXSOOHQMZTOX-GXUMUYLRSA-N |
| XLogP | 5.88 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|