C17H17ClN7O- — CID 143702076
2-N-(4-chloro-2-methylphenyl)-4-N-(5-cyclopropyl-1H-pyrazol-3-yl)-5-N-oxidopyrimidine-2,4,5-triamine (PubChem CID 143702076) has the molecular formula C17H17ClN7O- and a molecular weight of 370.82 g/mol. Its IUPAC name is 2-N-(4-chloro-2-methylphenyl)-4-N-(5-cyclopropyl-1H-pyrazol-3-yl)-5-N-oxidopyrimidine-2,4,5-triamine.
| Compound Name | 2-N-(4-chloro-2-methylphenyl)-4-N-(5-cyclopropyl-1H-pyrazol-3-yl)-5-N-oxidopyrimidine-2,4,5-triamine |
|---|---|
| PubChem CID | 143702076 |
| Molecular Formula | C17H17ClN7O- |
| Molecular Weight | 370.82 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 2-N-(4-chloro-2-methylphenyl)-4-N-(5-cyclopropyl-1H-pyrazol-3-yl)-5-N-oxidopyrimidine-2,4,5-triamine |
| SMILES | Cc1cc(Cl)ccc1Nc1ncc(N[O-])c(Nc2cc(C3CC3)[nH]n2)n1 |
| InChI | InChI=1S/C17H17ClN7O/c1-9-6-11(18)4-5-12(9)20-17-19-8-14(25-26)16(22-17)21-15-7-13(23-24-15)10-2-3-10/h4-8,10,25H,2-3H2,1H3,(H3,19,20,21,22,23,24)/q-1 |
| InChIKey | KPSMOMYMIMQVGY-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 113.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.82 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|