C15H14ClN5S — CID 90383982
5-chloro-N-(5-cyclopropyl-1H-pyrazol-3-yl)-2-(4-methylthiophen-2-yl)pyrimidin-4-amine (PubChem CID 90383982) has the molecular formula C15H14ClN5S and a molecular weight of 331.83 g/mol. Its IUPAC name is 5-chloro-N-(5-cyclopropyl-1H-pyrazol-3-yl)-2-(4-methylthiophen-2-yl)pyrimidin-4-amine.
| Compound Name | 5-chloro-N-(5-cyclopropyl-1H-pyrazol-3-yl)-2-(4-methylthiophen-2-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 90383982 |
| Molecular Formula | C15H14ClN5S |
| Molecular Weight | 331.83 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | 5-chloro-N-(5-cyclopropyl-1H-pyrazol-3-yl)-2-(4-methylthiophen-2-yl)pyrimidin-4-amine |
| SMILES | Cc1csc(-c2ncc(Cl)c(Nc3cc(C4CC4)[nH]n3)n2)c1 |
| InChI | InChI=1S/C15H14ClN5S/c1-8-4-12(22-7-8)15-17-6-10(16)14(19-15)18-13-5-11(20-21-13)9-2-3-9/h4-7,9H,2-3H2,1H3,(H2,17,18,19,20,21) |
| InChIKey | GHMCMSYDEYRBRC-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.83 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |