C16H15ClN6S — CID 90381576
5-chloro-N-(5-cyclopropyl-1H-pyrazol-3-yl)-2-(5-ethanimidoylthiophen-2-yl)pyrimidin-4-amine (PubChem CID 90381576) has the molecular formula C16H15ClN6S and a molecular weight of 358.86 g/mol. Its IUPAC name is 5-chloro-N-(5-cyclopropyl-1H-pyrazol-3-yl)-2-(5-ethanimidoylthiophen-2-yl)pyrimidin-4-amine.
| Compound Name | 5-chloro-N-(5-cyclopropyl-1H-pyrazol-3-yl)-2-(5-ethanimidoylthiophen-2-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 90381576 |
| Molecular Formula | C16H15ClN6S |
| Molecular Weight | 358.86 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 5-chloro-N-(5-cyclopropyl-1H-pyrazol-3-yl)-2-(5-ethanimidoylthiophen-2-yl)pyrimidin-4-amine |
| SMILES | [H]/N=C(\C)c1ccc(-c2ncc(Cl)c(Nc3cc(C4CC4)[nH]n3)n2)s1 |
| InChI | InChI=1S/C16H15ClN6S/c1-8(18)12-4-5-13(24-12)16-19-7-10(17)15(21-16)20-14-6-11(22-23-14)9-2-3-9/h4-7,9,18H,2-3H2,1H3,(H2,19,20,21,22,23)/b18-8+ |
| InChIKey | VWXIPOAJGOIDJQ-QGMBQPNBSA-N |
| XLogP | 4.59 |
| TPSA | 90.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.86 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|