C17H17BN5OS — CID 70792463
CID 70792463 (PubChem CID 70792463) has the molecular formula C17H17BN5OS and a molecular weight of 350.24 g/mol.
| Compound Name | CID 70792463 |
|---|---|
| PubChem CID | 70792463 |
| Molecular Formula | C17H17BN5OS |
| Molecular Weight | 350.24 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | — |
| SMILES | C[B]c1cnc(-c2ccc(C(C)=O)s2)nc1Nc1cc(C2CC2)[nH]n1 |
| InChI | InChI=1S/C17H17BN5OS/c1-9(24)13-5-6-14(25-13)17-19-8-11(18-2)16(21-17)20-15-7-12(22-23-15)10-3-4-10/h5-8,10H,3-4H2,1-2H3,(H2,19,20,21,22,23) |
| InChIKey | QYBBYMPTZQMTBB-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.24 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|