About CID 70792463
CID 70792463 (PubChem CID 70792463) has the molecular formula C17H17BN5OS
and a molecular weight of 350.24 g/mol.
Molecular Properties
| Compound Name | CID 70792463 |
| PubChem CID | 70792463 |
| Molecular Formula | C17H17BN5OS |
| Molecular Weight | 350.24 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | — |
| SMILES | C[B]c1cnc(-c2ccc(C(C)=O)s2)nc1Nc1cc(C2CC2)[nH]n1 |
| InChI | InChI=1S/C17H17BN5OS/c1-9(24)13-5-6-14(25-13)17-19-8-11(18-2)16(21-17)20-15-7-12(22-23-15)10-3-4-10/h5-8,10H,3-4H2,1-2H3,(H2,19,20,21,22,23) |
| InChIKey | QYBBYMPTZQMTBB-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.24 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 70792463 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 70792463?
The IUPAC name of CID 70792463 (CID 70792463) is not available.
What is the SMILES notation for CID 70792463?
The canonical SMILES for CID 70792463 is C[B]c1cnc(-c2ccc(C(C)=O)s2)nc1Nc1cc(C2CC2)[nH]n1.
What is the InChIKey of CID 70792463?
The InChIKey is QYBBYMPTZQMTBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17BN5OS/c1-9(24)13-5-6-14(25-13)17-19-8-11(18-2)16(21-17)20-15-7-12(22-23-15)10-3-4-10/h5-8,10H,3-4H2,1-2H3,(H2,19,20,21,22,23).
What are the key properties of CID 70792463?
CID 70792463 has a molecular weight of 350.24 g/mol, XLogP of 3.13, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 70792463 is sourced from PubChem (CID 70792463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).