C15H16ClN7S — CID 88974046
2-[5-chloro-4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]-2,3-dihydrothiophene-5-carboximidamide (PubChem CID 88974046) has the molecular formula C15H16ClN7S and a molecular weight of 361.86 g/mol. Its IUPAC name is 2-[5-chloro-4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]-2,3-dihydrothiophene-5-carboximidamide.
| Compound Name | 2-[5-chloro-4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]-2,3-dihydrothiophene-5-carboximidamide |
|---|---|
| PubChem CID | 88974046 |
| Molecular Formula | C15H16ClN7S |
| Molecular Weight | 361.86 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 2-[5-chloro-4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]-2,3-dihydrothiophene-5-carboximidamide |
| SMILES | [H]/N=C(\N)C1=CCC(c2ncc(Cl)c(Nc3cc(C4CC4)[nH]n3)n2)S1 |
| InChI | InChI=1S/C15H16ClN7S/c16-8-6-19-15(11-4-3-10(24-11)13(17)18)21-14(8)20-12-5-9(22-23-12)7-1-2-7/h3,5-7,11H,1-2,4H2,(H3,17,18)(H2,19,20,21,22,23) |
| InChIKey | WNLOOGFXLDHKBO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 116.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.86 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|