C25H21ClF3N3O3 — CID 143702820
3-[4-(4-chlorophenoxy)phenyl]-1-(3-nitrosopropyl)-4-[3-(trifluoromethyl)phenyl]imidazolidin-2-one (PubChem CID 143702820) has the molecular formula C25H21ClF3N3O3 and a molecular weight of 503.91 g/mol. Its IUPAC name is 3-[4-(4-chlorophenoxy)phenyl]-1-(3-nitrosopropyl)-4-[3-(trifluoromethyl)phenyl]imidazolidin-2-one.
| Compound Name | 3-[4-(4-chlorophenoxy)phenyl]-1-(3-nitrosopropyl)-4-[3-(trifluoromethyl)phenyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 143702820 |
| Molecular Formula | C25H21ClF3N3O3 |
| Molecular Weight | 503.91 g/mol |
| Exact Mass | 503.12 |
| IUPAC Name | 3-[4-(4-chlorophenoxy)phenyl]-1-(3-nitrosopropyl)-4-[3-(trifluoromethyl)phenyl]imidazolidin-2-one |
| SMILES | O=NCCCN1CC(c2cccc(C(F)(F)F)c2)N(c2ccc(Oc3ccc(Cl)cc3)cc2)C1=O |
| InChI | InChI=1S/C25H21ClF3N3O3/c26-19-5-9-21(10-6-19)35-22-11-7-20(8-12-22)32-23(16-31(24(32)33)14-2-13-30-34)17-3-1-4-18(15-17)25(27,28)29/h1,3-12,15,23H,2,13-14,16H2 |
| InChIKey | JNGXEAYPCCQQDI-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 62.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.91 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|