C26H21ClF3NO2 — CID 59485752
(3S,5R)-1-[4-(4-chlorophenoxy)phenyl]-3-prop-2-enyl-5-[3-(trifluoromethyl)phenyl]pyrrolidin-2-one (PubChem CID 59485752) has the molecular formula C26H21ClF3NO2 and a molecular weight of 471.91 g/mol. Its IUPAC name is (3S,5R)-1-[4-(4-chlorophenoxy)phenyl]-3-prop-2-enyl-5-[3-(trifluoromethyl)phenyl]pyrrolidin-2-one.
| Compound Name | (3S,5R)-1-[4-(4-chlorophenoxy)phenyl]-3-prop-2-enyl-5-[3-(trifluoromethyl)phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 59485752 |
| Molecular Formula | C26H21ClF3NO2 |
| Molecular Weight | 471.91 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | (3S,5R)-1-[4-(4-chlorophenoxy)phenyl]-3-prop-2-enyl-5-[3-(trifluoromethyl)phenyl]pyrrolidin-2-one |
| SMILES | C=CC[C@H]1C[C@H](c2cccc(C(F)(F)F)c2)N(c2ccc(Oc3ccc(Cl)cc3)cc2)C1=O |
| InChI | InChI=1S/C26H21ClF3NO2/c1-2-4-18-16-24(17-5-3-6-19(15-17)26(28,29)30)31(25(18)32)21-9-13-23(14-10-21)33-22-11-7-20(27)8-12-22/h2-3,5-15,18,24H,1,4,16H2/t18-,24+/m0/s1 |
| InChIKey | MTLFBIFFWJXZNB-MHECFPHRSA-N |
| XLogP | 7.82 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.91 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|