C28H26ClF3N2O3S — CID 25073620
3-[4-(4-chlorophenoxy)phenyl]-5-[2-oxo-3-(propylamino)propyl]-2-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one (PubChem CID 25073620) has the molecular formula C28H26ClF3N2O3S and a molecular weight of 563.04 g/mol. Its IUPAC name is 3-[4-(4-chlorophenoxy)phenyl]-5-[2-oxo-3-(propylamino)propyl]-2-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one.
| Compound Name | 3-[4-(4-chlorophenoxy)phenyl]-5-[2-oxo-3-(propylamino)propyl]-2-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 25073620 |
| Molecular Formula | C28H26ClF3N2O3S |
| Molecular Weight | 563.04 g/mol |
| Exact Mass | 562.13 |
| IUPAC Name | 3-[4-(4-chlorophenoxy)phenyl]-5-[2-oxo-3-(propylamino)propyl]-2-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one |
| SMILES | CCCNCC(=O)CC1SC(c2cccc(C(F)(F)F)c2)N(c2ccc(Oc3ccc(Cl)cc3)cc2)C1=O |
| InChI | InChI=1S/C28H26ClF3N2O3S/c1-2-14-33-17-22(35)16-25-26(36)34(27(38-25)18-4-3-5-19(15-18)28(30,31)32)21-8-12-24(13-9-21)37-23-10-6-20(29)7-11-23/h3-13,15,25,27,33H,2,14,16-17H2,1H3 |
| InChIKey | VWNIHODZQZLDSI-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.04 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|