C13H20N2 — CID 143703212
4-[2-(3,4-dihydropyridin-3-yl)ethyl]-2,3,6,7-tetrahydro-1H-azepine (PubChem CID 143703212) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is 4-[2-(3,4-dihydropyridin-3-yl)ethyl]-2,3,6,7-tetrahydro-1H-azepine.
| Compound Name | 4-[2-(3,4-dihydropyridin-3-yl)ethyl]-2,3,6,7-tetrahydro-1H-azepine |
|---|---|
| PubChem CID | 143703212 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 4-[2-(3,4-dihydropyridin-3-yl)ethyl]-2,3,6,7-tetrahydro-1H-azepine |
| SMILES | C1=CN=CC(CCC2=CCCNCC2)C1 |
| InChI | InChI=1S/C13H20N2/c1-3-12(7-10-14-8-1)5-6-13-4-2-9-15-11-13/h2-3,9,11,13-14H,1,4-8,10H2 |
| InChIKey | IAODYDOMKRHLCT-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|