C10H16N2 — CID 59042590
(3R)-3-(3H-pyrrol-3-ylmethyl)piperidine (PubChem CID 59042590) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is (3R)-3-(3H-pyrrol-3-ylmethyl)piperidine.
| Compound Name | (3R)-3-(3H-pyrrol-3-ylmethyl)piperidine |
|---|---|
| PubChem CID | 59042590 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | (3R)-3-(3H-pyrrol-3-ylmethyl)piperidine |
| SMILES | C1=CC(C[C@H]2CCCNC2)C=N1 |
| InChI | InChI=1S/C10H16N2/c1-2-9(7-11-4-1)6-10-3-5-12-8-10/h3,5,8-11H,1-2,4,6-7H2/t9-,10?/m1/s1 |
| InChIKey | NMTYUEROZVJUGS-YHMJZVADSA-N |
| XLogP | 1.59 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |