C20H23NS2 — CID 143703522
2-methyl-5-[(5E)-5-[(6Z)-octa-3,6-dien-1-yn-3-yl]sulfanylcycloocta-2,5-dien-1-yl]-1,3-thiazole (PubChem CID 143703522) has the molecular formula C20H23NS2 and a molecular weight of 341.55 g/mol. Its IUPAC name is 2-methyl-5-[(5E)-5-[(6Z)-octa-3,6-dien-1-yn-3-yl]sulfanylcycloocta-2,5-dien-1-yl]-1,3-thiazole.
| Compound Name | 2-methyl-5-[(5E)-5-[(6Z)-octa-3,6-dien-1-yn-3-yl]sulfanylcycloocta-2,5-dien-1-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 143703522 |
| Molecular Formula | C20H23NS2 |
| Molecular Weight | 341.55 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 2-methyl-5-[(5E)-5-[(6Z)-octa-3,6-dien-1-yn-3-yl]sulfanylcycloocta-2,5-dien-1-yl]-1,3-thiazole |
| SMILES | C#CC(=CC/C=C\C)S/C1=C/CCC(c2cnc(C)s2)C=CC1 |
| InChI | InChI=1S/C20H23NS2/c1-4-6-7-12-18(5-2)23-19-13-8-10-17(11-9-14-19)20-15-21-16(3)22-20/h2,4,6,8,10,12,14-15,17H,7,9,11,13H2,1,3H3/b6-4-,10-8?,18-12?,19-14+ |
| InChIKey | IUOZSKPLWIGLDS-MANOZMFBSA-N |
| XLogP | 6.38 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.55 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|