About 2-chloro-4-methylbenzonitrile;ethane;3-methyloctane
2-chloro-4-methylbenzonitrile;ethane;3-methyloctane (PubChem CID 143704166) has the molecular formula C19H32ClN
and a molecular weight of 309.93 g/mol. Its IUPAC name is 2-chloro-4-methylbenzonitrile;ethane;3-methyloctane.
Molecular Properties
| Compound Name | 2-chloro-4-methylbenzonitrile;ethane;3-methyloctane |
| PubChem CID | 143704166 |
| Molecular Formula | C19H32ClN |
| Molecular Weight | 309.93 g/mol |
| Exact Mass | 309.22 |
| IUPAC Name | 2-chloro-4-methylbenzonitrile;ethane;3-methyloctane |
| SMILES | CC.CCCCCC(C)CC.Cc1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C9H20.C8H6ClN.C2H6/c1-4-6-7-8-9(3)5-2;1-6-2-3-7(5-10)8(9)4-6;1-2/h9H,4-8H2,1-3H3;2-4H,1H3;1-2H3 |
| InChIKey | NLMXNDIGOHDCHD-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 309.93 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-4-methylbenzonitrile;ethane;3-methyloctane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-methylbenzonitrile;ethane;3-methyloctane?
The IUPAC name of 2-chloro-4-methylbenzonitrile;ethane;3-methyloctane (CID 143704166) is 2-chloro-4-methylbenzonitrile;ethane;3-methyloctane.
What is the SMILES notation for 2-chloro-4-methylbenzonitrile;ethane;3-methyloctane?
The canonical SMILES for 2-chloro-4-methylbenzonitrile;ethane;3-methyloctane is CC.CCCCCC(C)CC.Cc1ccc(C#N)c(Cl)c1.
What is the InChIKey of 2-chloro-4-methylbenzonitrile;ethane;3-methyloctane?
The InChIKey is NLMXNDIGOHDCHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20.C8H6ClN.C2H6/c1-4-6-7-8-9(3)5-2;1-6-2-3-7(5-10)8(9)4-6;1-2/h9H,4-8H2,1-3H3;2-4H,1H3;1-2H3.
What are the key properties of 2-chloro-4-methylbenzonitrile;ethane;3-methyloctane?
2-chloro-4-methylbenzonitrile;ethane;3-methyloctane has a molecular weight of 309.93 g/mol, XLogP of 7.16, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-methylbenzonitrile;ethane;3-methyloctane is sourced from PubChem (CID 143704166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).