C15H19N2O6P — CID 143705029
methyl 7-(diethoxyphosphanylmethyl)-3-hydroxy-4-oxopyrido[1,2-a]pyrimidine-2-carboxylate (PubChem CID 143705029) has the molecular formula C15H19N2O6P and a molecular weight of 354.30 g/mol. Its IUPAC name is methyl 7-(diethoxyphosphanylmethyl)-3-hydroxy-4-oxopyrido[1,2-a]pyrimidine-2-carboxylate.
| Compound Name | methyl 7-(diethoxyphosphanylmethyl)-3-hydroxy-4-oxopyrido[1,2-a]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 143705029 |
| Molecular Formula | C15H19N2O6P |
| Molecular Weight | 354.30 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | methyl 7-(diethoxyphosphanylmethyl)-3-hydroxy-4-oxopyrido[1,2-a]pyrimidine-2-carboxylate |
| SMILES | CCOP(Cc1ccc2nc(C(=O)OC)c(O)c(=O)n2c1)OCC |
| InChI | InChI=1S/C15H19N2O6P/c1-4-22-24(23-5-2)9-10-6-7-11-16-12(15(20)21-3)13(18)14(19)17(11)8-10/h6-8,18H,4-5,9H2,1-3H3 |
| InChIKey | JLVQLYNKQMLLBE-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.30 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|