C10H7IN2O4 — CID 58101054
methyl 3-hydroxy-7-iodo-4-oxopyrido[1,2-a]pyrimidine-2-carboxylate (PubChem CID 58101054) has the molecular formula C10H7IN2O4 and a molecular weight of 346.08 g/mol. Its IUPAC name is methyl 3-hydroxy-7-iodo-4-oxopyrido[1,2-a]pyrimidine-2-carboxylate.
| Compound Name | methyl 3-hydroxy-7-iodo-4-oxopyrido[1,2-a]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 58101054 |
| Molecular Formula | C10H7IN2O4 |
| Molecular Weight | 346.08 g/mol |
| Exact Mass | 345.95 |
| IUPAC Name | methyl 3-hydroxy-7-iodo-4-oxopyrido[1,2-a]pyrimidine-2-carboxylate |
| SMILES | COC(=O)c1nc2ccc(I)cn2c(=O)c1O |
| InChI | InChI=1S/C10H7IN2O4/c1-17-10(16)7-8(14)9(15)13-4-5(11)2-3-6(13)12-7/h2-4,14H,1H3 |
| InChIKey | TUZLCHGWXLLKDN-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.08 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|