C21H31N3 — CID 143705375
1-isoquinolin-6-yl-N-[(1-pentan-3-ylpyrrolidin-3-yl)methyl]ethanamine (PubChem CID 143705375) has the molecular formula C21H31N3 and a molecular weight of 325.50 g/mol. Its IUPAC name is 1-isoquinolin-6-yl-N-[(1-pentan-3-ylpyrrolidin-3-yl)methyl]ethanamine.
| Compound Name | 1-isoquinolin-6-yl-N-[(1-pentan-3-ylpyrrolidin-3-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 143705375 |
| Molecular Formula | C21H31N3 |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.25 |
| IUPAC Name | 1-isoquinolin-6-yl-N-[(1-pentan-3-ylpyrrolidin-3-yl)methyl]ethanamine |
| SMILES | CCC(CC)N1CCC(CNC(C)c2ccc3cnccc3c2)C1 |
| InChI | InChI=1S/C21H31N3/c1-4-21(5-2)24-11-9-17(15-24)13-23-16(3)18-6-7-20-14-22-10-8-19(20)12-18/h6-8,10,12,14,16-17,21,23H,4-5,9,11,13,15H2,1-3H3 |
| InChIKey | SIWHKPCSZVVEKO-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |