C15H17FN2 — CID 167838795
cis-(1R,2S)-2-fluoro-N-(1-isoquinolin-6-ylethyl)cyclobutan-1-amine (PubChem CID 167838795) has the molecular formula C15H17FN2 and a molecular weight of 244.31 g/mol. Its IUPAC name is cis-(1R,2S)-2-fluoro-N-(1-isoquinolin-6-ylethyl)cyclobutan-1-amine.
| Compound Name | cis-(1R,2S)-2-fluoro-N-(1-isoquinolin-6-ylethyl)cyclobutan-1-amine |
|---|---|
| PubChem CID | 167838795 |
| Molecular Formula | C15H17FN2 |
| Molecular Weight | 244.31 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | cis-(1R,2S)-2-fluoro-N-(1-isoquinolin-6-ylethyl)cyclobutan-1-amine |
| SMILES | CC(N[C@@H]1CC[C@@H]1F)c1ccc2cnccc2c1 |
| InChI | InChI=1S/C15H17FN2/c1-10(18-15-5-4-14(15)16)11-2-3-13-9-17-7-6-12(13)8-11/h2-3,6-10,14-15,18H,4-5H2,1H3/t10?,14-,15+/m0/s1 |
| InChIKey | UNWJZYUCMMOIQL-XVDHHWJWSA-N |
| XLogP | 3.39 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.31 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |