C13H19FN2 — CID 67650944
(3R,4R)-3-fluoro-N-[(1R)-1-phenylethyl]piperidin-4-amine (PubChem CID 67650944) has the molecular formula C13H19FN2 and a molecular weight of 222.31 g/mol. Its IUPAC name is (3R,4R)-3-fluoro-N-[(1R)-1-phenylethyl]piperidin-4-amine.
| Compound Name | (3R,4R)-3-fluoro-N-[(1R)-1-phenylethyl]piperidin-4-amine |
|---|---|
| PubChem CID | 67650944 |
| Molecular Formula | C13H19FN2 |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | (3R,4R)-3-fluoro-N-[(1R)-1-phenylethyl]piperidin-4-amine |
| SMILES | C[C@@H](N[C@@H]1CCNC[C@H]1F)c1ccccc1 |
| InChI | InChI=1S/C13H19FN2/c1-10(11-5-3-2-4-6-11)16-13-7-8-15-9-12(13)14/h2-6,10,12-13,15-16H,7-9H2,1H3/t10-,12-,13-/m1/s1 |
| InChIKey | WEAHXWFPBHUQGH-RAIGVLPGSA-N |
| XLogP | 2.04 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |