C17H28N2 — CID 149434678
(3R,4R)-3-butyl-N-(1-phenylethyl)piperidin-4-amine (PubChem CID 149434678) has the molecular formula C17H28N2 and a molecular weight of 260.43 g/mol. Its IUPAC name is (3R,4R)-3-butyl-N-(1-phenylethyl)piperidin-4-amine.
| Compound Name | (3R,4R)-3-butyl-N-(1-phenylethyl)piperidin-4-amine |
|---|---|
| PubChem CID | 149434678 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.43 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | (3R,4R)-3-butyl-N-(1-phenylethyl)piperidin-4-amine |
| SMILES | CCCC[C@@H]1CNCC[C@H]1NC(C)c1ccccc1 |
| InChI | InChI=1S/C17H28N2/c1-3-4-8-16-13-18-12-11-17(16)19-14(2)15-9-6-5-7-10-15/h5-7,9-10,14,16-19H,3-4,8,11-13H2,1-2H3/t14?,16-,17-/m1/s1 |
| InChIKey | YWXOQQIFONUEPJ-VNCLPFQGSA-N |
| XLogP | 3.51 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.43 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |