C17H28N2O2 — CID 69344181
3-butyl-N-(3,4-dimethoxyphenyl)piperidin-4-amine (PubChem CID 69344181) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is 3-butyl-N-(3,4-dimethoxyphenyl)piperidin-4-amine.
| Compound Name | 3-butyl-N-(3,4-dimethoxyphenyl)piperidin-4-amine |
|---|---|
| PubChem CID | 69344181 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 3-butyl-N-(3,4-dimethoxyphenyl)piperidin-4-amine |
| SMILES | CCCCC1CNCCC1Nc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C17H28N2O2/c1-4-5-6-13-12-18-10-9-15(13)19-14-7-8-16(20-2)17(11-14)21-3/h7-8,11,13,15,18-19H,4-6,9-10,12H2,1-3H3 |
| InChIKey | NAULMUKLXNGGBF-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|