C13H19NO3 — CID 82716607
N-(3,4-dimethoxyphenyl)-2-methyloxolan-3-amine (PubChem CID 82716607) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-2-methyloxolan-3-amine.
| Compound Name | N-(3,4-dimethoxyphenyl)-2-methyloxolan-3-amine |
|---|---|
| PubChem CID | 82716607 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-2-methyloxolan-3-amine |
| SMILES | COc1ccc(NC2CCOC2C)cc1OC |
| InChI | InChI=1S/C13H19NO3/c1-9-11(6-7-17-9)14-10-4-5-12(15-2)13(8-10)16-3/h4-5,8-9,11,14H,6-7H2,1-3H3 |
| InChIKey | LCFJQPOATUGGPS-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|